CAS No: 781612-89-3;635698-50-9, Chemical Name: 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine
the physical and chemical property of 781612-89-3;635698-50-9, 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine is provided by ChemNet.com
ChemNet > CAS > 781612-89-3;635698-50-9 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine
781612-89-3;635698-50-9 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine
| product Name |
2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
| Synonyms |
2,4-Dichloro-6,7,8,9-tetrahydro-5H-pyrimido[5,4-d]azepine; 5H-pyrimido[4,5-d]azepine, 2,4-dichloro-6,7,8,9-tetrahydro- |
| Molecular Formula |
C8H9Cl2N3 |
| Molecular Weight |
218.0832 |
| InChI |
InChI=1/C8H9Cl2N3/c9-7-5-1-3-11-4-2-6(5)12-8(10)13-7/h11H,1-4H2 |
| CAS Registry Number |
781612-89-3;635698-50-9 |
| Molecular Structure |
![781612-89-3;635698-50-9 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine](https://images-a.chemnet.com/suppliers/chembase/cas136/635698-50-9.png)
|
| Density |
1.359g/cm3 |
| Boiling point |
372.6°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
179.2°C |
| Vapour Pressur |
9.49E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
